C15H22O — CID 5370850
1,5,5-trimethyl-6-[(2E)-4-methylpenta-2,4-dien-2-yl]-7-oxabicyclo[4.1.0]hept-2-ene (PubChem CID 5370850) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is 1,5,5-trimethyl-6-[(2E)-4-methylpenta-2,4-dien-2-yl]-7-oxabicyclo[4.1.0]hept-2-ene.
| Compound Name | 1,5,5-trimethyl-6-[(2E)-4-methylpenta-2,4-dien-2-yl]-7-oxabicyclo[4.1.0]hept-2-ene |
|---|---|
| PubChem CID | 5370850 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 1,5,5-trimethyl-6-[(2E)-4-methylpenta-2,4-dien-2-yl]-7-oxabicyclo[4.1.0]hept-2-ene |
| SMILES | C=C(C)/C=C(\C)C12OC1(C)C=CCC2(C)C |
| InChI | InChI=1S/C15H22O/c1-11(2)10-12(3)15-13(4,5)8-7-9-14(15,6)16-15/h7,9-10H,1,8H2,2-6H3/b12-10+ |
| InChIKey | YGYMTTNGLBFAAM-ZRDIBKRKSA-N |
| XLogP | 4.02 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|