C9H12O — CID 58453069
2,2-dimethyl-1-oxaspiro[2.5]octa-4,6-diene (PubChem CID 58453069) has the molecular formula C9H12O and a molecular weight of 136.19 g/mol. Its IUPAC name is 2,2-dimethyl-1-oxaspiro[2.5]octa-4,6-diene.
| Compound Name | 2,2-dimethyl-1-oxaspiro[2.5]octa-4,6-diene |
|---|---|
| PubChem CID | 58453069 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | 2,2-dimethyl-1-oxaspiro[2.5]octa-4,6-diene |
| SMILES | CC1(C)OC12C=CC=CC2 |
| InChI | InChI=1S/C9H12O/c1-8(2)9(10-8)6-4-3-5-7-9/h3-6H,7H2,1-2H3 |
| InChIKey | IBZURGAQYSKUMH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|