C12H18O — CID 10535325
1,2,3,4,5,6-hexamethyl-7-oxabicyclo[4.1.0]hepta-2,4-diene (PubChem CID 10535325) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexamethyl-7-oxabicyclo[4.1.0]hepta-2,4-diene.
| Compound Name | 1,2,3,4,5,6-hexamethyl-7-oxabicyclo[4.1.0]hepta-2,4-diene |
|---|---|
| PubChem CID | 10535325 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 1,2,3,4,5,6-hexamethyl-7-oxabicyclo[4.1.0]hepta-2,4-diene |
| SMILES | CC1=C(C)C2(C)OC2(C)C(C)=C1C |
| InChI | InChI=1S/C12H18O/c1-7-8(2)10(4)12(6)11(5,13-12)9(7)3/h1-6H3 |
| InChIKey | QJXKILXNZJAFDP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|