C12H24O3Si — CID 10900882
tert-butyl-[(2-ethenyl-1,3-dioxolan-4-yl)methoxy]-dimethylsilane (PubChem CID 10900882) has the molecular formula C12H24O3Si and a molecular weight of 244.41 g/mol. Its IUPAC name is tert-butyl-[(2-ethenyl-1,3-dioxolan-4-yl)methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2-ethenyl-1,3-dioxolan-4-yl)methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10900882 |
| Molecular Formula | C12H24O3Si |
| Molecular Weight | 244.41 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | tert-butyl-[(2-ethenyl-1,3-dioxolan-4-yl)methoxy]-dimethylsilane |
| SMILES | C=CC1OCC(CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C12H24O3Si/c1-7-11-13-8-10(15-11)9-14-16(5,6)12(2,3)4/h7,10-11H,1,8-9H2,2-6H3 |
| InChIKey | BNQVAJLUOVTNHF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|