C18H40O4Si2 — CID 11143315
tert-butyl-dimethyl-[3-prop-2-enoxy-2-(2-trimethylsilylethoxymethoxy)propoxy]silane (PubChem CID 11143315) has the molecular formula C18H40O4Si2 and a molecular weight of 376.69 g/mol. Its IUPAC name is tert-butyl-dimethyl-[3-prop-2-enoxy-2-(2-trimethylsilylethoxymethoxy)propoxy]silane.
| Compound Name | tert-butyl-dimethyl-[3-prop-2-enoxy-2-(2-trimethylsilylethoxymethoxy)propoxy]silane |
|---|---|
| PubChem CID | 11143315 |
| Molecular Formula | C18H40O4Si2 |
| Molecular Weight | 376.69 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | tert-butyl-dimethyl-[3-prop-2-enoxy-2-(2-trimethylsilylethoxymethoxy)propoxy]silane |
| SMILES | C=CCOCC(CO[Si](C)(C)C(C)(C)C)OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C18H40O4Si2/c1-10-11-19-14-17(15-22-24(8,9)18(2,3)4)21-16-20-12-13-23(5,6)7/h10,17H,1,11-16H2,2-9H3 |
| InChIKey | ZUSAQUBTCQIVSY-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.69 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|