C20H42O4Si2 — CID 23240870
tert-butyl-[[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[(E)-prop-1-enyl]-1,3-dioxolan-4-yl]methoxy]-dimethylsilane (PubChem CID 23240870) has the molecular formula C20H42O4Si2 and a molecular weight of 402.72 g/mol. Its IUPAC name is tert-butyl-[[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[(E)-prop-1-enyl]-1,3-dioxolan-4-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[(E)-prop-1-enyl]-1,3-dioxolan-4-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 23240870 |
| Molecular Formula | C20H42O4Si2 |
| Molecular Weight | 402.72 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | tert-butyl-[[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[(E)-prop-1-enyl]-1,3-dioxolan-4-yl]methoxy]-dimethylsilane |
| SMILES | C/C=C/C1O[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C20H42O4Si2/c1-12-13-18-23-16(14-21-25(8,9)19(2,3)4)17(24-18)15-22-26(10,11)20(5,6)7/h12-13,16-18H,14-15H2,1-11H3/b13-12+/t16-,17-/m0/s1 |
| InChIKey | FDXMDBOLLRPGIU-CPQFKCLQSA-N |
| XLogP | 5.72 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.72 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|