C21H44O4Si2 — CID 23240874
[(4R,5R)-2-[(E)-but-2-en-2-yl]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-dioxolan-4-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 23240874) has the molecular formula C21H44O4Si2 and a molecular weight of 416.75 g/mol. Its IUPAC name is [(4R,5R)-2-[(E)-but-2-en-2-yl]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-dioxolan-4-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(4R,5R)-2-[(E)-but-2-en-2-yl]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-dioxolan-4-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 23240874 |
| Molecular Formula | C21H44O4Si2 |
| Molecular Weight | 416.75 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | [(4R,5R)-2-[(E)-but-2-en-2-yl]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-dioxolan-4-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | C/C=C(\C)C1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C21H44O4Si2/c1-13-16(2)19-24-17(14-22-26(9,10)20(3,4)5)18(25-19)15-23-27(11,12)21(6,7)8/h13,17-19H,14-15H2,1-12H3/b16-13+/t17-,18-/m1/s1 |
| InChIKey | NRCURZWWYSYRKY-PGSVNHOBSA-N |
| XLogP | 6.11 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.75 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|