C19H40O4Si2 — CID 23240877
tert-butyl-[[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-ethenyl-1,3-dioxolan-4-yl]methoxy]-dimethylsilane (PubChem CID 23240877) has the molecular formula C19H40O4Si2 and a molecular weight of 388.70 g/mol. Its IUPAC name is tert-butyl-[[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-ethenyl-1,3-dioxolan-4-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-ethenyl-1,3-dioxolan-4-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 23240877 |
| Molecular Formula | C19H40O4Si2 |
| Molecular Weight | 388.70 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | tert-butyl-[[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-ethenyl-1,3-dioxolan-4-yl]methoxy]-dimethylsilane |
| SMILES | C=CC1O[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C19H40O4Si2/c1-12-17-22-15(13-20-24(8,9)18(2,3)4)16(23-17)14-21-25(10,11)19(5,6)7/h12,15-17H,1,13-14H2,2-11H3/t15-,16-/m0/s1 |
| InChIKey | FBNXZDXSJPJRBQ-HOTGVXAUSA-N |
| XLogP | 5.33 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.70 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|