C17H34O4Si — CID 24823868
tert-butyl-[(2R)-2-(1-ethoxyprop-2-enoxy)-4-methoxypent-4-enoxy]-dimethylsilane (PubChem CID 24823868) has the molecular formula C17H34O4Si and a molecular weight of 330.54 g/mol. Its IUPAC name is tert-butyl-[(2R)-2-(1-ethoxyprop-2-enoxy)-4-methoxypent-4-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2R)-2-(1-ethoxyprop-2-enoxy)-4-methoxypent-4-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 24823868 |
| Molecular Formula | C17H34O4Si |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | tert-butyl-[(2R)-2-(1-ethoxyprop-2-enoxy)-4-methoxypent-4-enoxy]-dimethylsilane |
| SMILES | C=CC(OCC)O[C@@H](CO[Si](C)(C)C(C)(C)C)CC(=C)OC |
| InChI | InChI=1S/C17H34O4Si/c1-10-16(19-11-2)21-15(12-14(3)18-7)13-20-22(8,9)17(4,5)6/h10,15-16H,1,3,11-13H2,2,4-9H3/t15-,16?/m1/s1 |
| InChIKey | VHFZFKIBUUPMAH-AAFJCEBUSA-N |
| XLogP | 4.49 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|