C21H40O5Si2 — CID 134882929
tert-butyl-[1-[[(3R,4R)-3-[1-[tert-butyl(dimethyl)silyl]oxyethenoxy]-3,4-dihydro-2H-pyran-4-yl]oxy]ethenoxy]-dimethylsilane (PubChem CID 134882929) has the molecular formula C21H40O5Si2 and a molecular weight of 428.72 g/mol. Its IUPAC name is tert-butyl-[1-[[(3R,4R)-3-[1-[tert-butyl(dimethyl)silyl]oxyethenoxy]-3,4-dihydro-2H-pyran-4-yl]oxy]ethenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[1-[[(3R,4R)-3-[1-[tert-butyl(dimethyl)silyl]oxyethenoxy]-3,4-dihydro-2H-pyran-4-yl]oxy]ethenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134882929 |
| Molecular Formula | C21H40O5Si2 |
| Molecular Weight | 428.72 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | tert-butyl-[1-[[(3R,4R)-3-[1-[tert-butyl(dimethyl)silyl]oxyethenoxy]-3,4-dihydro-2H-pyran-4-yl]oxy]ethenoxy]-dimethylsilane |
| SMILES | C=C(O[C@@H]1C=COC[C@H]1OC(=C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H40O5Si2/c1-16(25-27(9,10)20(3,4)5)23-18-13-14-22-15-19(18)24-17(2)26-28(11,12)21(6,7)8/h13-14,18-19H,1-2,15H2,3-12H3/t18-,19-/m1/s1 |
| InChIKey | SUKSZFALRLRRRM-RTBURBONSA-N |
| XLogP | 6.29 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.72 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|