C22H44O6Si2 — CID 23240876
ethyl (E)-3-[(4S,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-dioxolan-2-yl]prop-2-enoate (PubChem CID 23240876) has the molecular formula C22H44O6Si2 and a molecular weight of 460.76 g/mol. Its IUPAC name is ethyl (E)-3-[(4S,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-dioxolan-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(4S,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-dioxolan-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 23240876 |
| Molecular Formula | C22H44O6Si2 |
| Molecular Weight | 460.76 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | ethyl (E)-3-[(4S,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-dioxolan-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/C1O[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C22H44O6Si2/c1-12-24-19(23)13-14-20-27-17(15-25-29(8,9)21(2,3)4)18(28-20)16-26-30(10,11)22(5,6)7/h13-14,17-18,20H,12,15-16H2,1-11H3/b14-13+/t17-,18-/m0/s1 |
| InChIKey | RTLAYXIUAKQKRV-BFRYPLHYSA-N |
| XLogP | 5.26 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.76 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|