C16H23N3O2 — CID 109017841
4-[3-(3,4-dimethylanilino)propanoyl]piperazine-1-carbaldehyde (PubChem CID 109017841) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 4-[3-(3,4-dimethylanilino)propanoyl]piperazine-1-carbaldehyde.
| Compound Name | 4-[3-(3,4-dimethylanilino)propanoyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 109017841 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 4-[3-(3,4-dimethylanilino)propanoyl]piperazine-1-carbaldehyde |
| SMILES | Cc1ccc(NCCC(=O)N2CCN(C=O)CC2)cc1C |
| InChI | InChI=1S/C16H23N3O2/c1-13-3-4-15(11-14(13)2)17-6-5-16(21)19-9-7-18(12-20)8-10-19/h3-4,11-12,17H,5-10H2,1-2H3 |
| InChIKey | NJXBCAFVBCTKMH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|