C17H25N3O5 — CID 109017916
4-[3-(3,4,5-trimethoxyanilino)propanoyl]piperazine-1-carbaldehyde (PubChem CID 109017916) has the molecular formula C17H25N3O5 and a molecular weight of 351.40 g/mol. Its IUPAC name is 4-[3-(3,4,5-trimethoxyanilino)propanoyl]piperazine-1-carbaldehyde.
| Compound Name | 4-[3-(3,4,5-trimethoxyanilino)propanoyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 109017916 |
| Molecular Formula | C17H25N3O5 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 4-[3-(3,4,5-trimethoxyanilino)propanoyl]piperazine-1-carbaldehyde |
| SMILES | COc1cc(NCCC(=O)N2CCN(C=O)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C17H25N3O5/c1-23-14-10-13(11-15(24-2)17(14)25-3)18-5-4-16(22)20-8-6-19(12-21)7-9-20/h10-12,18H,4-9H2,1-3H3 |
| InChIKey | OSRKCFOBIUJPCX-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|