C18H21BrN2O — CID 109019343
N-(3-bromo-4-methylphenyl)-3-[(2-methylphenyl)methylamino]propanamide (PubChem CID 109019343) has the molecular formula C18H21BrN2O and a molecular weight of 361.28 g/mol. Its IUPAC name is N-(3-bromo-4-methylphenyl)-3-[(2-methylphenyl)methylamino]propanamide.
| Compound Name | N-(3-bromo-4-methylphenyl)-3-[(2-methylphenyl)methylamino]propanamide |
|---|---|
| PubChem CID | 109019343 |
| Molecular Formula | C18H21BrN2O |
| Molecular Weight | 361.28 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | N-(3-bromo-4-methylphenyl)-3-[(2-methylphenyl)methylamino]propanamide |
| SMILES | Cc1ccc(NC(=O)CCNCc2ccccc2C)cc1Br |
| InChI | InChI=1S/C18H21BrN2O/c1-13-5-3-4-6-15(13)12-20-10-9-18(22)21-16-8-7-14(2)17(19)11-16/h3-8,11,20H,9-10,12H2,1-2H3,(H,21,22) |
| InChIKey | WLOBDGUPCLTICD-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.28 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|