C17H18BrFN2O — CID 109020973
N-(4-bromo-3-methylphenyl)-3-[(2-fluorophenyl)methylamino]propanamide (PubChem CID 109020973) has the molecular formula C17H18BrFN2O and a molecular weight of 365.25 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-3-[(2-fluorophenyl)methylamino]propanamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-3-[(2-fluorophenyl)methylamino]propanamide |
|---|---|
| PubChem CID | 109020973 |
| Molecular Formula | C17H18BrFN2O |
| Molecular Weight | 365.25 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-3-[(2-fluorophenyl)methylamino]propanamide |
| SMILES | Cc1cc(NC(=O)CCNCc2ccccc2F)ccc1Br |
| InChI | InChI=1S/C17H18BrFN2O/c1-12-10-14(6-7-15(12)18)21-17(22)8-9-20-11-13-4-2-3-5-16(13)19/h2-7,10,20H,8-9,11H2,1H3,(H,21,22) |
| InChIKey | JVYCDARRXWORSO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.25 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|