C20H26N2O4 — CID 109020525
N-benzyl-N-methyl-3-(3,4,5-trimethoxyanilino)propanamide (PubChem CID 109020525) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is N-benzyl-N-methyl-3-(3,4,5-trimethoxyanilino)propanamide.
| Compound Name | N-benzyl-N-methyl-3-(3,4,5-trimethoxyanilino)propanamide |
|---|---|
| PubChem CID | 109020525 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | N-benzyl-N-methyl-3-(3,4,5-trimethoxyanilino)propanamide |
| SMILES | COc1cc(NCCC(=O)N(C)Cc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C20H26N2O4/c1-22(14-15-8-6-5-7-9-15)19(23)10-11-21-16-12-17(24-2)20(26-4)18(13-16)25-3/h5-9,12-13,21H,10-11,14H2,1-4H3 |
| InChIKey | YQRRRUZROFJYJV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|