C18H20ClFN2O2 — CID 109020992
N-(4-chloro-2-methoxy-5-methylphenyl)-3-[(2-fluorophenyl)methylamino]propanamide (PubChem CID 109020992) has the molecular formula C18H20ClFN2O2 and a molecular weight of 350.82 g/mol. Its IUPAC name is N-(4-chloro-2-methoxy-5-methylphenyl)-3-[(2-fluorophenyl)methylamino]propanamide.
| Compound Name | N-(4-chloro-2-methoxy-5-methylphenyl)-3-[(2-fluorophenyl)methylamino]propanamide |
|---|---|
| PubChem CID | 109020992 |
| Molecular Formula | C18H20ClFN2O2 |
| Molecular Weight | 350.82 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | N-(4-chloro-2-methoxy-5-methylphenyl)-3-[(2-fluorophenyl)methylamino]propanamide |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)CCNCc1ccccc1F |
| InChI | InChI=1S/C18H20ClFN2O2/c1-12-9-16(17(24-2)10-14(12)19)22-18(23)7-8-21-11-13-5-3-4-6-15(13)20/h3-6,9-10,21H,7-8,11H2,1-2H3,(H,22,23) |
| InChIKey | MFCOQDOUXYHALM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.82 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|