C15H24ClN3O2 — CID 109016508
N-(4-chloro-2-methoxy-5-methylphenyl)-3-[2-(dimethylamino)ethylamino]propanamide (PubChem CID 109016508) has the molecular formula C15H24ClN3O2 and a molecular weight of 313.83 g/mol. Its IUPAC name is N-(4-chloro-2-methoxy-5-methylphenyl)-3-[2-(dimethylamino)ethylamino]propanamide.
| Compound Name | N-(4-chloro-2-methoxy-5-methylphenyl)-3-[2-(dimethylamino)ethylamino]propanamide |
|---|---|
| PubChem CID | 109016508 |
| Molecular Formula | C15H24ClN3O2 |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | N-(4-chloro-2-methoxy-5-methylphenyl)-3-[2-(dimethylamino)ethylamino]propanamide |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)CCNCCN(C)C |
| InChI | InChI=1S/C15H24ClN3O2/c1-11-9-13(14(21-4)10-12(11)16)18-15(20)5-6-17-7-8-19(2)3/h9-10,17H,5-8H2,1-4H3,(H,18,20) |
| InChIKey | JACLFUFFUUFAHA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|