C17H26ClN3O3 — CID 113160948
2-[acetyl-[3-(dimethylamino)propyl]amino]-N-(4-chloro-2-methoxy-5-methylphenyl)acetamide (PubChem CID 113160948) has the molecular formula C17H26ClN3O3 and a molecular weight of 355.87 g/mol. Its IUPAC name is 2-[acetyl-[3-(dimethylamino)propyl]amino]-N-(4-chloro-2-methoxy-5-methylphenyl)acetamide.
| Compound Name | 2-[acetyl-[3-(dimethylamino)propyl]amino]-N-(4-chloro-2-methoxy-5-methylphenyl)acetamide |
|---|---|
| PubChem CID | 113160948 |
| Molecular Formula | C17H26ClN3O3 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 2-[acetyl-[3-(dimethylamino)propyl]amino]-N-(4-chloro-2-methoxy-5-methylphenyl)acetamide |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)CN(CCCN(C)C)C(C)=O |
| InChI | InChI=1S/C17H26ClN3O3/c1-12-9-15(16(24-5)10-14(12)18)19-17(23)11-21(13(2)22)8-6-7-20(3)4/h9-10H,6-8,11H2,1-5H3,(H,19,23) |
| InChIKey | HBSGALZKPYHTOS-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |