C17H25ClN2O4 — CID 113117237
3-[acetyl(3-methoxypropyl)amino]-N-(4-chloro-2-methoxy-5-methylphenyl)propanamide (PubChem CID 113117237) has the molecular formula C17H25ClN2O4 and a molecular weight of 356.85 g/mol. Its IUPAC name is 3-[acetyl(3-methoxypropyl)amino]-N-(4-chloro-2-methoxy-5-methylphenyl)propanamide.
| Compound Name | 3-[acetyl(3-methoxypropyl)amino]-N-(4-chloro-2-methoxy-5-methylphenyl)propanamide |
|---|---|
| PubChem CID | 113117237 |
| Molecular Formula | C17H25ClN2O4 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 3-[acetyl(3-methoxypropyl)amino]-N-(4-chloro-2-methoxy-5-methylphenyl)propanamide |
| SMILES | COCCCN(CCC(=O)Nc1cc(C)c(Cl)cc1OC)C(C)=O |
| InChI | InChI=1S/C17H25ClN2O4/c1-12-10-15(16(24-4)11-14(12)18)19-17(22)6-8-20(13(2)21)7-5-9-23-3/h10-11H,5-9H2,1-4H3,(H,19,22) |
| InChIKey | IHQZMASRHLMMBI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|