C15H20Cl2N2O3 — CID 113117231
3-[acetyl(3-methoxypropyl)amino]-N-(2,4-dichlorophenyl)propanamide (PubChem CID 113117231) has the molecular formula C15H20Cl2N2O3 and a molecular weight of 347.24 g/mol. Its IUPAC name is 3-[acetyl(3-methoxypropyl)amino]-N-(2,4-dichlorophenyl)propanamide.
| Compound Name | 3-[acetyl(3-methoxypropyl)amino]-N-(2,4-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 113117231 |
| Molecular Formula | C15H20Cl2N2O3 |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 3-[acetyl(3-methoxypropyl)amino]-N-(2,4-dichlorophenyl)propanamide |
| SMILES | COCCCN(CCC(=O)Nc1ccc(Cl)cc1Cl)C(C)=O |
| InChI | InChI=1S/C15H20Cl2N2O3/c1-11(20)19(7-3-9-22-2)8-6-15(21)18-14-5-4-12(16)10-13(14)17/h4-5,10H,3,6-9H2,1-2H3,(H,18,21) |
| InChIKey | WLYATGGMIWCSIQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|