C16H25ClN2O3 — CID 110881535
2-[butyl(2-hydroxyethyl)amino]-N-(4-chloro-2-methoxy-5-methylphenyl)acetamide (PubChem CID 110881535) has the molecular formula C16H25ClN2O3 and a molecular weight of 328.84 g/mol. Its IUPAC name is 2-[butyl(2-hydroxyethyl)amino]-N-(4-chloro-2-methoxy-5-methylphenyl)acetamide.
| Compound Name | 2-[butyl(2-hydroxyethyl)amino]-N-(4-chloro-2-methoxy-5-methylphenyl)acetamide |
|---|---|
| PubChem CID | 110881535 |
| Molecular Formula | C16H25ClN2O3 |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 2-[butyl(2-hydroxyethyl)amino]-N-(4-chloro-2-methoxy-5-methylphenyl)acetamide |
| SMILES | CCCCN(CCO)CC(=O)Nc1cc(C)c(Cl)cc1OC |
| InChI | InChI=1S/C16H25ClN2O3/c1-4-5-6-19(7-8-20)11-16(21)18-14-9-12(2)13(17)10-15(14)22-3/h9-10,20H,4-8,11H2,1-3H3,(H,18,21) |
| InChIKey | SGNBZSYQJZKBCP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |