C20H26ClN3O2 — CID 120871651
2-[2-aminoethyl(2-phenylethyl)amino]-N-(4-chloro-2-methoxy-5-methylphenyl)acetamide (PubChem CID 120871651) has the molecular formula C20H26ClN3O2 and a molecular weight of 375.90 g/mol. Its IUPAC name is 2-[2-aminoethyl(2-phenylethyl)amino]-N-(4-chloro-2-methoxy-5-methylphenyl)acetamide.
| Compound Name | 2-[2-aminoethyl(2-phenylethyl)amino]-N-(4-chloro-2-methoxy-5-methylphenyl)acetamide |
|---|---|
| PubChem CID | 120871651 |
| Molecular Formula | C20H26ClN3O2 |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 2-[2-aminoethyl(2-phenylethyl)amino]-N-(4-chloro-2-methoxy-5-methylphenyl)acetamide |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)CN(CCN)CCc1ccccc1 |
| InChI | InChI=1S/C20H26ClN3O2/c1-15-12-18(19(26-2)13-17(15)21)23-20(25)14-24(11-9-22)10-8-16-6-4-3-5-7-16/h3-7,12-13H,8-11,14,22H2,1-2H3,(H,23,25) |
| InChIKey | OBODYOBIPNAHAE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |