C17H15ClF4N2O — CID 109021116
3-[2-chloro-5-(trifluoromethyl)anilino]-N-[(4-fluorophenyl)methyl]propanamide (PubChem CID 109021116) has the molecular formula C17H15ClF4N2O and a molecular weight of 374.77 g/mol. Its IUPAC name is 3-[2-chloro-5-(trifluoromethyl)anilino]-N-[(4-fluorophenyl)methyl]propanamide.
| Compound Name | 3-[2-chloro-5-(trifluoromethyl)anilino]-N-[(4-fluorophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 109021116 |
| Molecular Formula | C17H15ClF4N2O |
| Molecular Weight | 374.77 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 3-[2-chloro-5-(trifluoromethyl)anilino]-N-[(4-fluorophenyl)methyl]propanamide |
| SMILES | O=C(CCNc1cc(C(F)(F)F)ccc1Cl)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C17H15ClF4N2O/c18-14-6-3-12(17(20,21)22)9-15(14)23-8-7-16(25)24-10-11-1-4-13(19)5-2-11/h1-6,9,23H,7-8,10H2,(H,24,25) |
| InChIKey | LIVUKKGUPFYMEG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.77 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |