C17H21N3O — CID 10902113
1-cyclohexyl-3,6-dihydro-2H-pyrimido[2,1-b]quinazolin-4-one (PubChem CID 10902113) has the molecular formula C17H21N3O and a molecular weight of 283.37 g/mol. Its IUPAC name is 1-cyclohexyl-3,6-dihydro-2H-pyrimido[2,1-b]quinazolin-4-one.
| Compound Name | 1-cyclohexyl-3,6-dihydro-2H-pyrimido[2,1-b]quinazolin-4-one |
|---|---|
| PubChem CID | 10902113 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 1-cyclohexyl-3,6-dihydro-2H-pyrimido[2,1-b]quinazolin-4-one |
| SMILES | O=C1CCN(C2CCCCC2)C2=Nc3ccccc3CN12 |
| InChI | InChI=1S/C17H21N3O/c21-16-10-11-19(14-7-2-1-3-8-14)17-18-15-9-5-4-6-13(15)12-20(16)17/h4-6,9,14H,1-3,7-8,10-12H2 |
| InChIKey | YCOSXOYTRBNEKN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |