C17H33N3O — CID 10902523
(2R)-2-[(Z)-hept-1-enyl]-1,5,9-triazacyclotridecan-4-one (PubChem CID 10902523) has the molecular formula C17H33N3O and a molecular weight of 295.47 g/mol. Its IUPAC name is (2R)-2-[(Z)-hept-1-enyl]-1,5,9-triazacyclotridecan-4-one.
| Compound Name | (2R)-2-[(Z)-hept-1-enyl]-1,5,9-triazacyclotridecan-4-one |
|---|---|
| PubChem CID | 10902523 |
| Molecular Formula | C17H33N3O |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.26 |
| IUPAC Name | (2R)-2-[(Z)-hept-1-enyl]-1,5,9-triazacyclotridecan-4-one |
| SMILES | CCCCC/C=C\[C@H]1CC(=O)NCCCNCCCCN1 |
| InChI | InChI=1S/C17H33N3O/c1-2-3-4-5-6-10-16-15-17(21)20-14-9-12-18-11-7-8-13-19-16/h6,10,16,18-19H,2-5,7-9,11-15H2,1H3,(H,20,21)/b10-6-/t16-/m0/s1 |
| InChIKey | MARPCEKTLJUZQK-DIEDAUMRSA-N |
| XLogP | 2.36 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|