C21H26N2O2 — CID 109025652
1-(3,4-dihydro-2H-quinolin-1-yl)-3-[2-(3-methoxyphenyl)ethylamino]propan-1-one (PubChem CID 109025652) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-quinolin-1-yl)-3-[2-(3-methoxyphenyl)ethylamino]propan-1-one.
| Compound Name | 1-(3,4-dihydro-2H-quinolin-1-yl)-3-[2-(3-methoxyphenyl)ethylamino]propan-1-one |
|---|---|
| PubChem CID | 109025652 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 1-(3,4-dihydro-2H-quinolin-1-yl)-3-[2-(3-methoxyphenyl)ethylamino]propan-1-one |
| SMILES | COc1cccc(CCNCCC(=O)N2CCCc3ccccc32)c1 |
| InChI | InChI=1S/C21H26N2O2/c1-25-19-9-4-6-17(16-19)11-13-22-14-12-21(24)23-15-5-8-18-7-2-3-10-20(18)23/h2-4,6-7,9-10,16,22H,5,8,11-15H2,1H3 |
| InChIKey | SDQICPIBQKMGFH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|