C11H13Cl3O4 — CID 10903163
ethyl (1R,4R,5R)-6,6-dimethyl-2-oxo-4-(trichloromethyl)-3-oxabicyclo[3.1.0]hexane-1-carboxylate (PubChem CID 10903163) has the molecular formula C11H13Cl3O4 and a molecular weight of 315.58 g/mol. Its IUPAC name is ethyl (1R,4R,5R)-6,6-dimethyl-2-oxo-4-(trichloromethyl)-3-oxabicyclo[3.1.0]hexane-1-carboxylate.
| Compound Name | ethyl (1R,4R,5R)-6,6-dimethyl-2-oxo-4-(trichloromethyl)-3-oxabicyclo[3.1.0]hexane-1-carboxylate |
|---|---|
| PubChem CID | 10903163 |
| Molecular Formula | C11H13Cl3O4 |
| Molecular Weight | 315.58 g/mol |
| Exact Mass | 313.99 |
| IUPAC Name | ethyl (1R,4R,5R)-6,6-dimethyl-2-oxo-4-(trichloromethyl)-3-oxabicyclo[3.1.0]hexane-1-carboxylate |
| SMILES | CCOC(=O)[C@@]12C(=O)O[C@@H](C(Cl)(Cl)Cl)[C@@H]1C2(C)C |
| InChI | InChI=1S/C11H13Cl3O4/c1-4-17-7(15)10-5(9(10,2)3)6(11(12,13)14)18-8(10)16/h5-6H,4H2,1-3H3/t5-,6-,10-/m1/s1 |
| InChIKey | ABCUPIFJNBDJMS-OXOINMOOSA-N |
| XLogP | 2.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.58 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|