C22H25F3N2O — CID 109032580
3-(4-benzylpiperidin-1-yl)-N-[4-(trifluoromethyl)phenyl]propanamide (PubChem CID 109032580) has the molecular formula C22H25F3N2O and a molecular weight of 390.45 g/mol. Its IUPAC name is 3-(4-benzylpiperidin-1-yl)-N-[4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-(4-benzylpiperidin-1-yl)-N-[4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 109032580 |
| Molecular Formula | C22H25F3N2O |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 3-(4-benzylpiperidin-1-yl)-N-[4-(trifluoromethyl)phenyl]propanamide |
| SMILES | O=C(CCN1CCC(Cc2ccccc2)CC1)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H25F3N2O/c23-22(24,25)19-6-8-20(9-7-19)26-21(28)12-15-27-13-10-18(11-14-27)16-17-4-2-1-3-5-17/h1-9,18H,10-16H2,(H,26,28) |
| InChIKey | OUTLDXPHZWQIGE-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |