C18H37NO3Si — CID 10904030
methyl N-[(E,6S)-6-tri(propan-2-yl)silyloxyhept-4-en-3-yl]carbamate (PubChem CID 10904030) has the molecular formula C18H37NO3Si and a molecular weight of 343.58 g/mol. Its IUPAC name is methyl N-[(E,6S)-6-tri(propan-2-yl)silyloxyhept-4-en-3-yl]carbamate.
| Compound Name | methyl N-[(E,6S)-6-tri(propan-2-yl)silyloxyhept-4-en-3-yl]carbamate |
|---|---|
| PubChem CID | 10904030 |
| Molecular Formula | C18H37NO3Si |
| Molecular Weight | 343.58 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | methyl N-[(E,6S)-6-tri(propan-2-yl)silyloxyhept-4-en-3-yl]carbamate |
| SMILES | CCC(/C=C/[C@H](C)O[Si](C(C)C)(C(C)C)C(C)C)NC(=O)OC |
| InChI | InChI=1S/C18H37NO3Si/c1-10-17(19-18(20)21-9)12-11-16(8)22-23(13(2)3,14(4)5)15(6)7/h11-17H,10H2,1-9H3,(H,19,20)/b12-11+/t16-,17?/m0/s1 |
| InChIKey | KTEYIWHHHNGSMR-FSNYXLCYSA-N |
| XLogP | 5.26 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.58 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|