C17H14F3N3O — CID 109040794
N-(4-cyanophenyl)-3-[3-(trifluoromethyl)anilino]propanamide (PubChem CID 109040794) has the molecular formula C17H14F3N3O and a molecular weight of 333.31 g/mol. Its IUPAC name is N-(4-cyanophenyl)-3-[3-(trifluoromethyl)anilino]propanamide.
| Compound Name | N-(4-cyanophenyl)-3-[3-(trifluoromethyl)anilino]propanamide |
|---|---|
| PubChem CID | 109040794 |
| Molecular Formula | C17H14F3N3O |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | N-(4-cyanophenyl)-3-[3-(trifluoromethyl)anilino]propanamide |
| SMILES | N#Cc1ccc(NC(=O)CCNc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C17H14F3N3O/c18-17(19,20)13-2-1-3-15(10-13)22-9-8-16(24)23-14-6-4-12(11-21)5-7-14/h1-7,10,22H,8-9H2,(H,23,24) |
| InChIKey | FROHFLMGXYKUFN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |