C19H21ClN2O5 — CID 109042359
N-(4-chloro-2,5-dimethoxyphenyl)-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)propanamide (PubChem CID 109042359) has the molecular formula C19H21ClN2O5 and a molecular weight of 392.84 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)propanamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)propanamide |
|---|---|
| PubChem CID | 109042359 |
| Molecular Formula | C19H21ClN2O5 |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)propanamide |
| SMILES | COc1cc(NC(=O)CCNc2ccc3c(c2)OCCO3)c(OC)cc1Cl |
| InChI | InChI=1S/C19H21ClN2O5/c1-24-16-11-14(17(25-2)10-13(16)20)22-19(23)5-6-21-12-3-4-15-18(9-12)27-8-7-26-15/h3-4,9-11,21H,5-8H2,1-2H3,(H,22,23) |
| InChIKey | QNEJSDLLQLKRRG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|