C24H21N3O2 — CID 109054951
3-N-benzyl-1-N-(2-cyanophenyl)-3-N-ethylbenzene-1,3-dicarboxamide (PubChem CID 109054951) has the molecular formula C24H21N3O2 and a molecular weight of 383.45 g/mol. Its IUPAC name is 3-N-benzyl-1-N-(2-cyanophenyl)-3-N-ethylbenzene-1,3-dicarboxamide.
| Compound Name | 3-N-benzyl-1-N-(2-cyanophenyl)-3-N-ethylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109054951 |
| Molecular Formula | C24H21N3O2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 3-N-benzyl-1-N-(2-cyanophenyl)-3-N-ethylbenzene-1,3-dicarboxamide |
| SMILES | CCN(Cc1ccccc1)C(=O)c1cccc(C(=O)Nc2ccccc2C#N)c1 |
| InChI | InChI=1S/C24H21N3O2/c1-2-27(17-18-9-4-3-5-10-18)24(29)20-13-8-12-19(15-20)23(28)26-22-14-7-6-11-21(22)16-25/h3-15H,2,17H2,1H3,(H,26,28) |
| InChIKey | HPRJRQRMMSDKHJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |