C23H27ClN2O2 — CID 109055680
N-[2-(4-chlorophenyl)ethyl]-3-(2-ethylpiperidine-1-carbonyl)benzamide (PubChem CID 109055680) has the molecular formula C23H27ClN2O2 and a molecular weight of 398.93 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-3-(2-ethylpiperidine-1-carbonyl)benzamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-3-(2-ethylpiperidine-1-carbonyl)benzamide |
|---|---|
| PubChem CID | 109055680 |
| Molecular Formula | C23H27ClN2O2 |
| Molecular Weight | 398.93 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-3-(2-ethylpiperidine-1-carbonyl)benzamide |
| SMILES | CCC1CCCCN1C(=O)c1cccc(C(=O)NCCc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C23H27ClN2O2/c1-2-21-8-3-4-15-26(21)23(28)19-7-5-6-18(16-19)22(27)25-14-13-17-9-11-20(24)12-10-17/h5-7,9-12,16,21H,2-4,8,13-15H2,1H3,(H,25,27) |
| InChIKey | ZCIQFFANMJFNIU-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.93 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |