C23H17N3O4 — CID 109057734
methyl 3-[[3-[(2-cyanophenyl)carbamoyl]benzoyl]amino]benzoate (PubChem CID 109057734) has the molecular formula C23H17N3O4 and a molecular weight of 399.41 g/mol. Its IUPAC name is methyl 3-[[3-[(2-cyanophenyl)carbamoyl]benzoyl]amino]benzoate.
| Compound Name | methyl 3-[[3-[(2-cyanophenyl)carbamoyl]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 109057734 |
| Molecular Formula | C23H17N3O4 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | methyl 3-[[3-[(2-cyanophenyl)carbamoyl]benzoyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2cccc(C(=O)Nc3ccccc3C#N)c2)c1 |
| InChI | InChI=1S/C23H17N3O4/c1-30-23(29)17-9-5-10-19(13-17)25-21(27)15-7-4-8-16(12-15)22(28)26-20-11-3-2-6-18(20)14-24/h2-13H,1H3,(H,25,27)(H,26,28) |
| InChIKey | CRMLHNNKZHZIEV-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |