C19H17N3O2 — CID 95568631
N-(2-cyanophenyl)-3-[[(1S,2S)-2-methylcyclopropanecarbonyl]amino]benzamide (PubChem CID 95568631) has the molecular formula C19H17N3O2 and a molecular weight of 319.36 g/mol. Its IUPAC name is N-(2-cyanophenyl)-3-[[(1S,2S)-2-methylcyclopropanecarbonyl]amino]benzamide.
| Compound Name | N-(2-cyanophenyl)-3-[[(1S,2S)-2-methylcyclopropanecarbonyl]amino]benzamide |
|---|---|
| PubChem CID | 95568631 |
| Molecular Formula | C19H17N3O2 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | N-(2-cyanophenyl)-3-[[(1S,2S)-2-methylcyclopropanecarbonyl]amino]benzamide |
| SMILES | C[C@H]1C[C@@H]1C(=O)Nc1cccc(C(=O)Nc2ccccc2C#N)c1 |
| InChI | InChI=1S/C19H17N3O2/c1-12-9-16(12)19(24)21-15-7-4-6-13(10-15)18(23)22-17-8-3-2-5-14(17)11-20/h2-8,10,12,16H,9H2,1H3,(H,21,24)(H,22,23)/t12-,16-/m0/s1 |
| InChIKey | IFZPFFNIEIXNFA-LRDDRELGSA-N |
| XLogP | 3.41 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |