C15H22FN3O3S — CID 1090625
N-[2-(4-ethylpiperazin-1-yl)-2-oxoethyl]-N-(3-fluorophenyl)methanesulfonamide (PubChem CID 1090625) has the molecular formula C15H22FN3O3S and a molecular weight of 343.42 g/mol. Its IUPAC name is N-[2-(4-ethylpiperazin-1-yl)-2-oxoethyl]-N-(3-fluorophenyl)methanesulfonamide.
| Compound Name | N-[2-(4-ethylpiperazin-1-yl)-2-oxoethyl]-N-(3-fluorophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 1090625 |
| Molecular Formula | C15H22FN3O3S |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | N-[2-(4-ethylpiperazin-1-yl)-2-oxoethyl]-N-(3-fluorophenyl)methanesulfonamide |
| SMILES | CCN1CCN(C(=O)CN(c2cccc(F)c2)S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C15H22FN3O3S/c1-3-17-7-9-18(10-8-17)15(20)12-19(23(2,21)22)14-6-4-5-13(16)11-14/h4-6,11H,3,7-10,12H2,1-2H3 |
| InChIKey | HDUDETVQIJZQIT-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |