C18H26F3N3O3S — CID 53286539
N-[4-(4-ethylpiperazin-1-yl)-4-oxobutyl]-N-[3-(trifluoromethyl)phenyl]methanesulfonamide (PubChem CID 53286539) has the molecular formula C18H26F3N3O3S and a molecular weight of 421.49 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)-4-oxobutyl]-N-[3-(trifluoromethyl)phenyl]methanesulfonamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)-4-oxobutyl]-N-[3-(trifluoromethyl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 53286539 |
| Molecular Formula | C18H26F3N3O3S |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)-4-oxobutyl]-N-[3-(trifluoromethyl)phenyl]methanesulfonamide |
| SMILES | CCN1CCN(C(=O)CCCN(c2cccc(C(F)(F)F)c2)S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C18H26F3N3O3S/c1-3-22-10-12-23(13-11-22)17(25)8-5-9-24(28(2,26)27)16-7-4-6-15(14-16)18(19,20)21/h4,6-7,14H,3,5,8-13H2,1-2H3 |
| InChIKey | JQEZTHXIGLIUGD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |