C23H29F3N4O3S — CID 53286944
N-[4-(4-methylpiperazin-1-yl)phenyl]-4-[N-methylsulfonyl-3-(trifluoromethyl)anilino]butanamide (PubChem CID 53286944) has the molecular formula C23H29F3N4O3S and a molecular weight of 498.57 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-4-[N-methylsulfonyl-3-(trifluoromethyl)anilino]butanamide.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-4-[N-methylsulfonyl-3-(trifluoromethyl)anilino]butanamide |
|---|---|
| PubChem CID | 53286944 |
| Molecular Formula | C23H29F3N4O3S |
| Molecular Weight | 498.57 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-4-[N-methylsulfonyl-3-(trifluoromethyl)anilino]butanamide |
| SMILES | CN1CCN(c2ccc(NC(=O)CCCN(c3cccc(C(F)(F)F)c3)S(C)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C23H29F3N4O3S/c1-28-13-15-29(16-14-28)20-10-8-19(9-11-20)27-22(31)7-4-12-30(34(2,32)33)21-6-3-5-18(17-21)23(24,25)26/h3,5-6,8-11,17H,4,7,12-16H2,1-2H3,(H,27,31) |
| InChIKey | HSIOFBAIIJWBPQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.57 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|