C21H18ClF3N2OS — CID 10906285
1-[5-[[(1-chloro-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinolin-11-yl)amino]methyl]thiophen-2-yl]-2,2,2-trifluoroethanone (PubChem CID 10906285) has the molecular formula C21H18ClF3N2OS and a molecular weight of 438.90 g/mol. Its IUPAC name is 1-[5-[[(1-chloro-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinolin-11-yl)amino]methyl]thiophen-2-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[5-[[(1-chloro-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinolin-11-yl)amino]methyl]thiophen-2-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 10906285 |
| Molecular Formula | C21H18ClF3N2OS |
| Molecular Weight | 438.90 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 1-[5-[[(1-chloro-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinolin-11-yl)amino]methyl]thiophen-2-yl]-2,2,2-trifluoroethanone |
| SMILES | O=C(c1ccc(CNc2c3c(nc4cccc(Cl)c24)CCCCC3)s1)C(F)(F)F |
| InChI | InChI=1S/C21H18ClF3N2OS/c22-14-6-4-8-16-18(14)19(13-5-2-1-3-7-15(13)27-16)26-11-12-9-10-17(29-12)20(28)21(23,24)25/h4,6,8-10H,1-3,5,7,11H2,(H,26,27) |
| InChIKey | QNPYGSSPRXBFQL-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.90 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |