C21H28N2O3S — CID 109065532
N-butyl-3-[ethyl-(3-methylphenyl)sulfamoyl]-N-methylbenzamide (PubChem CID 109065532) has the molecular formula C21H28N2O3S and a molecular weight of 388.53 g/mol. Its IUPAC name is N-butyl-3-[ethyl-(3-methylphenyl)sulfamoyl]-N-methylbenzamide.
| Compound Name | N-butyl-3-[ethyl-(3-methylphenyl)sulfamoyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 109065532 |
| Molecular Formula | C21H28N2O3S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | N-butyl-3-[ethyl-(3-methylphenyl)sulfamoyl]-N-methylbenzamide |
| SMILES | CCCCN(C)C(=O)c1cccc(S(=O)(=O)N(CC)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C21H28N2O3S/c1-5-7-14-22(4)21(24)18-11-9-13-20(16-18)27(25,26)23(6-2)19-12-8-10-17(3)15-19/h8-13,15-16H,5-7,14H2,1-4H3 |
| InChIKey | WZQGDUDYOFVZIB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |