C18H22N4O2 — CID 109066867
3-(3-methylpiperidine-1-carbonyl)-N-prop-2-enylimidazo[1,5-a]pyridine-1-carboxamide (PubChem CID 109066867) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 3-(3-methylpiperidine-1-carbonyl)-N-prop-2-enylimidazo[1,5-a]pyridine-1-carboxamide.
| Compound Name | 3-(3-methylpiperidine-1-carbonyl)-N-prop-2-enylimidazo[1,5-a]pyridine-1-carboxamide |
|---|---|
| PubChem CID | 109066867 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 3-(3-methylpiperidine-1-carbonyl)-N-prop-2-enylimidazo[1,5-a]pyridine-1-carboxamide |
| SMILES | C=CCNC(=O)c1nc(C(=O)N2CCCC(C)C2)n2ccccc12 |
| InChI | InChI=1S/C18H22N4O2/c1-3-9-19-17(23)15-14-8-4-5-11-22(14)16(20-15)18(24)21-10-6-7-13(2)12-21/h3-5,8,11,13H,1,6-7,9-10,12H2,2H3,(H,19,23) |
| InChIKey | SDHRYIOYEOMPHR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|