C17H19N5O3 — CID 109066817
3-(4-formylpiperazine-1-carbonyl)-N-prop-2-enylimidazo[1,5-a]pyridine-1-carboxamide (PubChem CID 109066817) has the molecular formula C17H19N5O3 and a molecular weight of 341.37 g/mol. Its IUPAC name is 3-(4-formylpiperazine-1-carbonyl)-N-prop-2-enylimidazo[1,5-a]pyridine-1-carboxamide.
| Compound Name | 3-(4-formylpiperazine-1-carbonyl)-N-prop-2-enylimidazo[1,5-a]pyridine-1-carboxamide |
|---|---|
| PubChem CID | 109066817 |
| Molecular Formula | C17H19N5O3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 3-(4-formylpiperazine-1-carbonyl)-N-prop-2-enylimidazo[1,5-a]pyridine-1-carboxamide |
| SMILES | C=CCNC(=O)c1nc(C(=O)N2CCN(C=O)CC2)n2ccccc12 |
| InChI | InChI=1S/C17H19N5O3/c1-2-6-18-16(24)14-13-5-3-4-7-22(13)15(19-14)17(25)21-10-8-20(12-23)9-11-21/h2-5,7,12H,1,6,8-11H2,(H,18,24) |
| InChIKey | FLCPNLWNKKGURV-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 87.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|