C21H21N5O3 — CID 109070043
N-benzyl-1-(4-formylpiperazine-1-carbonyl)imidazo[1,5-a]pyridine-3-carboxamide (PubChem CID 109070043) has the molecular formula C21H21N5O3 and a molecular weight of 391.43 g/mol. Its IUPAC name is N-benzyl-1-(4-formylpiperazine-1-carbonyl)imidazo[1,5-a]pyridine-3-carboxamide.
| Compound Name | N-benzyl-1-(4-formylpiperazine-1-carbonyl)imidazo[1,5-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109070043 |
| Molecular Formula | C21H21N5O3 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | N-benzyl-1-(4-formylpiperazine-1-carbonyl)imidazo[1,5-a]pyridine-3-carboxamide |
| SMILES | O=CN1CCN(C(=O)c2nc(C(=O)NCc3ccccc3)n3ccccc23)CC1 |
| InChI | InChI=1S/C21H21N5O3/c27-15-24-10-12-25(13-11-24)21(29)18-17-8-4-5-9-26(17)19(23-18)20(28)22-14-16-6-2-1-3-7-16/h1-9,15H,10-14H2,(H,22,28) |
| InChIKey | WAXLNZLNRFDFJE-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 87.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|