C19H18N4O2 — CID 109066660
1-N-benzyl-3-N-cyclopropylimidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109066660) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is 1-N-benzyl-3-N-cyclopropylimidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 1-N-benzyl-3-N-cyclopropylimidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109066660 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 1-N-benzyl-3-N-cyclopropylimidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | O=C(NCc1ccccc1)c1nc(C(=O)NC2CC2)n2ccccc12 |
| InChI | InChI=1S/C19H18N4O2/c24-18(20-12-13-6-2-1-3-7-13)16-15-8-4-5-11-23(15)17(22-16)19(25)21-14-9-10-14/h1-8,11,14H,9-10,12H2,(H,20,24)(H,21,25) |
| InChIKey | GTPRGFUILULAFG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |