C23H20N4O2 — CID 109070283
3-N-benzyl-1-N-(4-methylphenyl)imidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109070283) has the molecular formula C23H20N4O2 and a molecular weight of 384.44 g/mol. Its IUPAC name is 3-N-benzyl-1-N-(4-methylphenyl)imidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 3-N-benzyl-1-N-(4-methylphenyl)imidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109070283 |
| Molecular Formula | C23H20N4O2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 3-N-benzyl-1-N-(4-methylphenyl)imidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)c2nc(C(=O)NCc3ccccc3)n3ccccc23)cc1 |
| InChI | InChI=1S/C23H20N4O2/c1-16-10-12-18(13-11-16)25-22(28)20-19-9-5-6-14-27(19)21(26-20)23(29)24-15-17-7-3-2-4-8-17/h2-14H,15H2,1H3,(H,24,29)(H,25,28) |
| InChIKey | ILNMDCYILGNVBH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |