C22H26N4O2 — CID 109070393
3-N-[(4-methylphenyl)methyl]-1-N-pentylimidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109070393) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is 3-N-[(4-methylphenyl)methyl]-1-N-pentylimidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 3-N-[(4-methylphenyl)methyl]-1-N-pentylimidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109070393 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 3-N-[(4-methylphenyl)methyl]-1-N-pentylimidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | CCCCCNC(=O)c1nc(C(=O)NCc2ccc(C)cc2)n2ccccc12 |
| InChI | InChI=1S/C22H26N4O2/c1-3-4-6-13-23-21(27)19-18-8-5-7-14-26(18)20(25-19)22(28)24-15-17-11-9-16(2)10-12-17/h5,7-12,14H,3-4,6,13,15H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | DREXYZACKFYPJR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|