C21H23ClN4O2 — CID 109070525
1-N-[(4-chlorophenyl)methyl]-3-N-pentylimidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109070525) has the molecular formula C21H23ClN4O2 and a molecular weight of 398.89 g/mol. Its IUPAC name is 1-N-[(4-chlorophenyl)methyl]-3-N-pentylimidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 1-N-[(4-chlorophenyl)methyl]-3-N-pentylimidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109070525 |
| Molecular Formula | C21H23ClN4O2 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 1-N-[(4-chlorophenyl)methyl]-3-N-pentylimidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | CCCCCNC(=O)c1nc(C(=O)NCc2ccc(Cl)cc2)c2ccccn12 |
| InChI | InChI=1S/C21H23ClN4O2/c1-2-3-5-12-23-21(28)19-25-18(17-7-4-6-13-26(17)19)20(27)24-14-15-8-10-16(22)11-9-15/h4,6-11,13H,2-3,5,12,14H2,1H3,(H,23,28)(H,24,27) |
| InChIKey | VEALCSOUULHACG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|