C22H18N4O2 — CID 109070239
1-N-benzyl-3-N-phenylimidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109070239) has the molecular formula C22H18N4O2 and a molecular weight of 370.41 g/mol. Its IUPAC name is 1-N-benzyl-3-N-phenylimidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 1-N-benzyl-3-N-phenylimidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109070239 |
| Molecular Formula | C22H18N4O2 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 1-N-benzyl-3-N-phenylimidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | O=C(NCc1ccccc1)c1nc(C(=O)Nc2ccccc2)n2ccccc12 |
| InChI | InChI=1S/C22H18N4O2/c27-21(23-15-16-9-3-1-4-10-16)19-18-13-7-8-14-26(18)20(25-19)22(28)24-17-11-5-2-6-12-17/h1-14H,15H2,(H,23,27)(H,24,28) |
| InChIKey | MDBQDHHGMBKMNJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |