C21H15FN4O2 — CID 109071855
1-N-(3-fluorophenyl)-3-N-phenylimidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109071855) has the molecular formula C21H15FN4O2 and a molecular weight of 374.38 g/mol. Its IUPAC name is 1-N-(3-fluorophenyl)-3-N-phenylimidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 1-N-(3-fluorophenyl)-3-N-phenylimidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109071855 |
| Molecular Formula | C21H15FN4O2 |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 1-N-(3-fluorophenyl)-3-N-phenylimidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | O=C(Nc1cccc(F)c1)c1nc(C(=O)Nc2ccccc2)n2ccccc12 |
| InChI | InChI=1S/C21H15FN4O2/c22-14-7-6-10-16(13-14)24-20(27)18-17-11-4-5-12-26(17)19(25-18)21(28)23-15-8-2-1-3-9-15/h1-13H,(H,23,28)(H,24,27) |
| InChIKey | XUWABWWDPCIJEZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |